C9H20N2O2S — CID 112661509
2-amino-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid (PubChem CID 112661509) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-amino-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid.
| Compound Name | 2-amino-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 112661509 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-amino-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid |
| SMILES | CCC(CSC)N(C)CC(N)C(=O)O |
| InChI | InChI=1S/C9H20N2O2S/c1-4-7(6-14-3)11(2)5-8(10)9(12)13/h7-8H,4-6,10H2,1-3H3,(H,12,13) |
| InChIKey | OHFNGCBWNLRFGD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |