C10H21NS2 — CID 103073536
2-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073536) has the molecular formula C10H21NS2 and a molecular weight of 219.42 g/mol. Its IUPAC name is 2-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073536 |
| Molecular Formula | C10H21NS2 |
| Molecular Weight | 219.42 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(C)C(CC)CSC |
| InChI | InChI=1S/C10H21NS2/c1-5-10(8-13-4)11(3)6-9(2)7-12/h10,12H,2,5-8H2,1,3-4H3 |
| InChIKey | MAFJXYUIMAJYGU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|