C14H30N2S — CID 103071191
N-tert-butyl-N'-methyl-2-methylidene-N'-(1-methylsulfanylbutan-2-yl)propane-1,3-diamine (PubChem CID 103071191) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-2-methylidene-N'-(1-methylsulfanylbutan-2-yl)propane-1,3-diamine.
| Compound Name | N-tert-butyl-N'-methyl-2-methylidene-N'-(1-methylsulfanylbutan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103071191 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-tert-butyl-N'-methyl-2-methylidene-N'-(1-methylsulfanylbutan-2-yl)propane-1,3-diamine |
| SMILES | C=C(CNC(C)(C)C)CN(C)C(CC)CSC |
| InChI | InChI=1S/C14H30N2S/c1-8-13(11-17-7)16(6)10-12(2)9-15-14(3,4)5/h13,15H,2,8-11H2,1,3-7H3 |
| InChIKey | HATHIHFYMPSIRB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|