C9H18BF3NS- — CID 106746228
trifluoro-[3-[methyl(1-methylsulfanylbutan-2-yl)amino]prop-1-en-2-yl]boranuide (PubChem CID 106746228) has the molecular formula C9H18BF3NS- and a molecular weight of 240.12 g/mol. Its IUPAC name is trifluoro-[3-[methyl(1-methylsulfanylbutan-2-yl)amino]prop-1-en-2-yl]boranuide.
| Compound Name | trifluoro-[3-[methyl(1-methylsulfanylbutan-2-yl)amino]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746228 |
| Molecular Formula | C9H18BF3NS- |
| Molecular Weight | 240.12 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | trifluoro-[3-[methyl(1-methylsulfanylbutan-2-yl)amino]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN(C)C(CC)CSC)[B-](F)(F)F |
| InChI | InChI=1S/C9H18BF3NS/c1-5-9(7-15-4)14(3)6-8(2)10(11,12)13/h9H,2,5-7H2,1,3-4H3/q-1 |
| InChIKey | VTLJLIDIWQXRFL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|