C9H18BF3KN — CID 106745749
potassium trifluoro-[3-[methyl(pentan-2-yl)amino]prop-1-en-2-yl]boranuide (PubChem CID 106745749) has the molecular formula C9H18BF3KN and a molecular weight of 247.15 g/mol. Its IUPAC name is potassium trifluoro-[3-[methyl(pentan-2-yl)amino]prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-[methyl(pentan-2-yl)amino]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106745749 |
| Molecular Formula | C9H18BF3KN |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | potassium trifluoro-[3-[methyl(pentan-2-yl)amino]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN(C)C(C)CCC)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C9H18BF3N.K/c1-5-6-9(3)14(4)7-8(2)10(11,12)13;/h9H,2,5-7H2,1,3-4H3;/q-1;+1 |
| InChIKey | RSYSFSKNBRLRLJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|