C7H11BF6N- — CID 106745916
3-[ethyl(2,2,2-trifluoroethyl)amino]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106745916) has the molecular formula C7H11BF6N- and a molecular weight of 233.97 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethyl)amino]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106745916 |
| Molecular Formula | C7H11BF6N- |
| Molecular Weight | 233.97 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN(CC)CC(F)(F)F)[B-](F)(F)F |
| InChI | InChI=1S/C7H11BF6N/c1-3-15(5-7(9,10)11)4-6(2)8(12,13)14/h2-5H2,1H3/q-1 |
| InChIKey | FOUAPBSXJLQMKQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|