C13H30N2OS — CID 112658783
1-(tert-butylamino)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propan-2-ol (PubChem CID 112658783) has the molecular formula C13H30N2OS and a molecular weight of 262.46 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 112658783 |
| Molecular Formula | C13H30N2OS |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 1-(tert-butylamino)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propan-2-ol |
| SMILES | CCC(CSC)N(C)CC(O)CNC(C)(C)C |
| InChI | InChI=1S/C13H30N2OS/c1-7-11(10-17-6)15(5)9-12(16)8-14-13(2,3)4/h11-12,14,16H,7-10H2,1-6H3 |
| InChIKey | JWBGFAXIQDYODJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |