C15H34N2S — CID 112665724
N'-methyl-N-(2-methylpropyl)-N'-(1-methylsulfanylbutan-2-yl)pentane-1,5-diamine (PubChem CID 112665724) has the molecular formula C15H34N2S and a molecular weight of 274.52 g/mol. Its IUPAC name is N'-methyl-N-(2-methylpropyl)-N'-(1-methylsulfanylbutan-2-yl)pentane-1,5-diamine.
| Compound Name | N'-methyl-N-(2-methylpropyl)-N'-(1-methylsulfanylbutan-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 112665724 |
| Molecular Formula | C15H34N2S |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N'-methyl-N-(2-methylpropyl)-N'-(1-methylsulfanylbutan-2-yl)pentane-1,5-diamine |
| SMILES | CCC(CSC)N(C)CCCCCNCC(C)C |
| InChI | InChI=1S/C15H34N2S/c1-6-15(13-18-5)17(4)11-9-7-8-10-16-12-14(2)3/h14-16H,6-13H2,1-5H3 |
| InChIKey | CLYJDFBSUBUFMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|