C17H38N2 — CID 79482264
N'-ethyl-N'-(2-methylbutyl)-N-(2-methylpropyl)hexane-1,6-diamine (PubChem CID 79482264) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methylbutyl)-N-(2-methylpropyl)hexane-1,6-diamine.
| Compound Name | N'-ethyl-N'-(2-methylbutyl)-N-(2-methylpropyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 79482264 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | N'-ethyl-N'-(2-methylbutyl)-N-(2-methylpropyl)hexane-1,6-diamine |
| SMILES | CCC(C)CN(CC)CCCCCCNCC(C)C |
| InChI | InChI=1S/C17H38N2/c1-6-17(5)15-19(7-2)13-11-9-8-10-12-18-14-16(3)4/h16-18H,6-15H2,1-5H3 |
| InChIKey | QHQLOPFXGLHRPH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|