C11H26N2 — CID 155282396
2-N-hexan-3-yl-2-N-methylbutane-1,2-diamine (PubChem CID 155282396) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 2-N-hexan-3-yl-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-hexan-3-yl-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 155282396 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 2-N-hexan-3-yl-2-N-methylbutane-1,2-diamine |
| SMILES | CCCC(CC)N(C)C(CC)CN |
| InChI | InChI=1S/C11H26N2/c1-5-8-10(6-2)13(4)11(7-3)9-12/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | JSYMWIKTPUZXJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |