C13H30N2 — CID 61436765
2-N-ethyl-2-N-(2-ethylbutyl)pentane-1,2-diamine (PubChem CID 61436765) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(2-ethylbutyl)pentane-1,2-diamine.
| Compound Name | 2-N-ethyl-2-N-(2-ethylbutyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 61436765 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-N-ethyl-2-N-(2-ethylbutyl)pentane-1,2-diamine |
| SMILES | CCCC(CN)N(CC)CC(CC)CC |
| InChI | InChI=1S/C13H30N2/c1-5-9-13(10-14)15(8-4)11-12(6-2)7-3/h12-13H,5-11,14H2,1-4H3 |
| InChIKey | WRUVOHDIOKGTKW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |