C15H34N2 — CID 61436771
3-N-ethyl-3-N-(2-ethylbutyl)heptane-3,4-diamine (PubChem CID 61436771) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 3-N-ethyl-3-N-(2-ethylbutyl)heptane-3,4-diamine.
| Compound Name | 3-N-ethyl-3-N-(2-ethylbutyl)heptane-3,4-diamine |
|---|---|
| PubChem CID | 61436771 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 3-N-ethyl-3-N-(2-ethylbutyl)heptane-3,4-diamine |
| SMILES | CCCC(N)C(CC)N(CC)CC(CC)CC |
| InChI | InChI=1S/C15H34N2/c1-6-11-14(16)15(9-4)17(10-5)12-13(7-2)8-3/h13-15H,6-12,16H2,1-5H3 |
| InChIKey | OHXXNGQIQUPNGF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |