C6H17N3 — CID 18471403
2-N,2-N-dimethylbutane-1,2,4-triamine (PubChem CID 18471403) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is 2-N,2-N-dimethylbutane-1,2,4-triamine.
| Compound Name | 2-N,2-N-dimethylbutane-1,2,4-triamine |
|---|---|
| PubChem CID | 18471403 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 2-N,2-N-dimethylbutane-1,2,4-triamine |
| SMILES | CN(C)C(CN)CCN |
| InChI | InChI=1S/C6H17N3/c1-9(2)6(5-8)3-4-7/h6H,3-5,7-8H2,1-2H3 |
| InChIKey | UNYMMHPGJMGGDJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |