C10H26N4 — CID 57125116
3-N,3-N,4-N,4-N-tetramethylhexane-1,3,4,6-tetramine (PubChem CID 57125116) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N-tetramethylhexane-1,3,4,6-tetramine.
| Compound Name | 3-N,3-N,4-N,4-N-tetramethylhexane-1,3,4,6-tetramine |
|---|---|
| PubChem CID | 57125116 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 3-N,3-N,4-N,4-N-tetramethylhexane-1,3,4,6-tetramine |
| SMILES | CN(C)C(CCN)C(CCN)N(C)C |
| InChI | InChI=1S/C10H26N4/c1-13(2)9(5-7-11)10(6-8-12)14(3)4/h9-10H,5-8,11-12H2,1-4H3 |
| InChIKey | BVPFIKRXHAYDMR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |