C12H30N4 — CID 88835277
1-N,1-N,2-N,2-N-tetramethyloctane-1,2,3,8-tetramine (PubChem CID 88835277) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetramethyloctane-1,2,3,8-tetramine.
| Compound Name | 1-N,1-N,2-N,2-N-tetramethyloctane-1,2,3,8-tetramine |
|---|---|
| PubChem CID | 88835277 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetramethyloctane-1,2,3,8-tetramine |
| SMILES | CN(C)CC(C(N)CCCCCN)N(C)C |
| InChI | InChI=1S/C12H30N4/c1-15(2)10-12(16(3)4)11(14)8-6-5-7-9-13/h11-12H,5-10,13-14H2,1-4H3 |
| InChIKey | SGKVKZYJBJSYMA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|