C6H16N2O2 — CID 139889741
3-N,3-N-dihydroxy-4-methylpentane-1,3-diamine (PubChem CID 139889741) has the molecular formula C6H16N2O2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-N,3-N-dihydroxy-4-methylpentane-1,3-diamine.
| Compound Name | 3-N,3-N-dihydroxy-4-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 139889741 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | 3-N,3-N-dihydroxy-4-methylpentane-1,3-diamine |
| SMILES | CC(C)C(CCN)N(O)O |
| InChI | InChI=1S/C6H16N2O2/c1-5(2)6(3-4-7)8(9)10/h5-6,9-10H,3-4,7H2,1-2H3 |
| InChIKey | BYQGXOMJDPSAST-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|