C10H22N2 — CID 130414542
(Z)-4-methyl-3-propan-2-ylhex-4-ene-1,5-diamine (PubChem CID 130414542) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (Z)-4-methyl-3-propan-2-ylhex-4-ene-1,5-diamine.
| Compound Name | (Z)-4-methyl-3-propan-2-ylhex-4-ene-1,5-diamine |
|---|---|
| PubChem CID | 130414542 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (Z)-4-methyl-3-propan-2-ylhex-4-ene-1,5-diamine |
| SMILES | C/C(N)=C(\C)C(CCN)C(C)C |
| InChI | InChI=1S/C10H22N2/c1-7(2)10(5-6-11)8(3)9(4)12/h7,10H,5-6,11-12H2,1-4H3/b9-8- |
| InChIKey | FYWSRJURUHLQEO-HJWRWDBZSA-N |
| XLogP | 1.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |