C7H18N2 — CID 18183747
1-N',1-N'-dimethylpentane-1,1-diamine (PubChem CID 18183747) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is 1-N',1-N'-dimethylpentane-1,1-diamine.
| Compound Name | 1-N',1-N'-dimethylpentane-1,1-diamine |
|---|---|
| PubChem CID | 18183747 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 1-N',1-N'-dimethylpentane-1,1-diamine |
| SMILES | CCCCC(N)N(C)C |
| InChI | InChI=1S/C7H18N2/c1-4-5-6-7(8)9(2)3/h7H,4-6,8H2,1-3H3 |
| InChIKey | KIFAWRXRABRNPC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|