About 2-chlorobutane;silane
2-chlorobutane;silane (PubChem CID 174414093) has the molecular formula C4H13ClSi
and a molecular weight of 124.69 g/mol. Its IUPAC name is 2-chlorobutane;silane.
Molecular Properties
| Compound Name | 2-chlorobutane;silane |
| PubChem CID | 174414093 |
| Molecular Formula | C4H13ClSi |
| Molecular Weight | 124.69 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 2-chlorobutane;silane |
| SMILES | CCC(C)Cl.[SiH4] |
| InChI | InChI=1S/C4H9Cl.H4Si/c1-3-4(2)5;/h4H,3H2,1-2H3;1H4 |
| InChIKey | GORUJDNZPZBXEJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.69 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutane;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutane;silane?
The IUPAC name of 2-chlorobutane;silane (CID 174414093) is 2-chlorobutane;silane.
What is the SMILES notation for 2-chlorobutane;silane?
The canonical SMILES for 2-chlorobutane;silane is CCC(C)Cl.[SiH4].
What is the InChIKey of 2-chlorobutane;silane?
The InChIKey is GORUJDNZPZBXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl.H4Si/c1-3-4(2)5;/h4H,3H2,1-2H3;1H4.
What are the key properties of 2-chlorobutane;silane?
2-chlorobutane;silane has a molecular weight of 124.69 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutane;silane is sourced from PubChem (CID 174414093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).