About ethane;1-methoxyethanol
ethane;1-methoxyethanol (PubChem CID 157348595) has the molecular formula C13H38O2
and a molecular weight of 226.44 g/mol. Its IUPAC name is ethane;1-methoxyethanol.
Molecular Properties
| Compound Name | ethane;1-methoxyethanol |
| PubChem CID | 157348595 |
| Molecular Formula | C13H38O2 |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.29 |
| IUPAC Name | ethane;1-methoxyethanol |
| SMILES | CC.CC.CC.CC.CC.COC(C)O |
| InChI | InChI=1S/C3H8O2.5C2H6/c1-3(4)5-2;5*1-2/h3-4H,1-2H3;5*1-2H3 |
| InChIKey | BHGNZHYMHWEYLS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxyethanol?
The IUPAC name of ethane;1-methoxyethanol (CID 157348595) is ethane;1-methoxyethanol.
What is the SMILES notation for ethane;1-methoxyethanol?
The canonical SMILES for ethane;1-methoxyethanol is CC.CC.CC.CC.CC.COC(C)O.
What is the InChIKey of ethane;1-methoxyethanol?
The InChIKey is BHGNZHYMHWEYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.5C2H6/c1-3(4)5-2;5*1-2/h3-4H,1-2H3;5*1-2H3.
What are the key properties of ethane;1-methoxyethanol?
ethane;1-methoxyethanol has a molecular weight of 226.44 g/mol, XLogP of 5.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxyethanol is sourced from PubChem (CID 157348595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).