About 1-hydroxyethyl hypobromite
1-hydroxyethyl hypobromite (PubChem CID 141268184) has the molecular formula C2H5BrO2
and a molecular weight of 140.96 g/mol. Its IUPAC name is 1-hydroxyethyl hypobromite.
Molecular Properties
| Compound Name | 1-hydroxyethyl hypobromite |
| PubChem CID | 141268184 |
| Molecular Formula | C2H5BrO2 |
| Molecular Weight | 140.96 g/mol |
| Exact Mass | 139.95 |
| IUPAC Name | 1-hydroxyethyl hypobromite |
| SMILES | CC(O)OBr |
| InChI | InChI=1S/C2H5BrO2/c1-2(4)5-3/h2,4H,1H3 |
| InChIKey | CMNFESNRUUOSRG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.96 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl hypobromite?
The IUPAC name of 1-hydroxyethyl hypobromite (CID 141268184) is 1-hydroxyethyl hypobromite.
What is the SMILES notation for 1-hydroxyethyl hypobromite?
The canonical SMILES for 1-hydroxyethyl hypobromite is CC(O)OBr.
What is the InChIKey of 1-hydroxyethyl hypobromite?
The InChIKey is CMNFESNRUUOSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5BrO2/c1-2(4)5-3/h2,4H,1H3.
What are the key properties of 1-hydroxyethyl hypobromite?
1-hydroxyethyl hypobromite has a molecular weight of 140.96 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl hypobromite is sourced from PubChem (CID 141268184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).