C6H12Br2O2 — CID 102249432
2,5-dibromohexane-3,4-diol (PubChem CID 102249432) has the molecular formula C6H12Br2O2 and a molecular weight of 275.97 g/mol. Its IUPAC name is 2,5-dibromohexane-3,4-diol.
| Compound Name | 2,5-dibromohexane-3,4-diol |
|---|---|
| PubChem CID | 102249432 |
| Molecular Formula | C6H12Br2O2 |
| Molecular Weight | 275.97 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | 2,5-dibromohexane-3,4-diol |
| SMILES | CC(Br)C(O)C(O)C(C)Br |
| InChI | InChI=1S/C6H12Br2O2/c1-3(7)5(9)6(10)4(2)8/h3-6,9-10H,1-2H3 |
| InChIKey | DVUONZINUDLWKQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.97 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|