C4H7Br3O — CID 23054816
1,1,3-tribromobutan-2-ol (PubChem CID 23054816) has the molecular formula C4H7Br3O and a molecular weight of 310.81 g/mol. Its IUPAC name is 1,1,3-tribromobutan-2-ol.
| Compound Name | 1,1,3-tribromobutan-2-ol |
|---|---|
| PubChem CID | 23054816 |
| Molecular Formula | C4H7Br3O |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 307.80 |
| IUPAC Name | 1,1,3-tribromobutan-2-ol |
| SMILES | CC(Br)C(O)C(Br)Br |
| InChI | InChI=1S/C4H7Br3O/c1-2(5)3(8)4(6)7/h2-4,8H,1H3 |
| InChIKey | NPNMSJDSHXTMSQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|