C2H3Br3O — CID 19422875
1,2,2-tribromoethanol (PubChem CID 19422875) has the molecular formula C2H3Br3O and a molecular weight of 282.76 g/mol. Its IUPAC name is 1,2,2-tribromoethanol.
| Compound Name | 1,2,2-tribromoethanol |
|---|---|
| PubChem CID | 19422875 |
| Molecular Formula | C2H3Br3O |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 279.77 |
| IUPAC Name | 1,2,2-tribromoethanol |
| SMILES | OC(Br)C(Br)Br |
| InChI | InChI=1S/C2H3Br3O/c3-1(4)2(5)6/h1-2,6H |
| InChIKey | CYSBUYMIEUUBAP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|