About 1-bromo-2,2-difluoroethanol
1-bromo-2,2-difluoroethanol (PubChem CID 87083635) has the molecular formula C2H3BrF2O
and a molecular weight of 160.95 g/mol. Its IUPAC name is 1-bromo-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-bromo-2,2-difluoroethanol |
| PubChem CID | 87083635 |
| Molecular Formula | C2H3BrF2O |
| Molecular Weight | 160.95 g/mol |
| Exact Mass | 159.93 |
| IUPAC Name | 1-bromo-2,2-difluoroethanol |
| SMILES | OC(Br)C(F)F |
| InChI | InChI=1S/C2H3BrF2O/c3-1(6)2(4)5/h1-2,6H |
| InChIKey | CXVXKYXQOWNIHF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.95 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,2-difluoroethanol?
The IUPAC name of 1-bromo-2,2-difluoroethanol (CID 87083635) is 1-bromo-2,2-difluoroethanol.
What is the SMILES notation for 1-bromo-2,2-difluoroethanol?
The canonical SMILES for 1-bromo-2,2-difluoroethanol is OC(Br)C(F)F.
What is the InChIKey of 1-bromo-2,2-difluoroethanol?
The InChIKey is CXVXKYXQOWNIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrF2O/c3-1(6)2(4)5/h1-2,6H.
What are the key properties of 1-bromo-2,2-difluoroethanol?
1-bromo-2,2-difluoroethanol has a molecular weight of 160.95 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,2-difluoroethanol is sourced from PubChem (CID 87083635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).