C2H3BrF2O — CID 87083635
1-bromo-2,2-difluoroethanol (PubChem CID 87083635) has the molecular formula C2H3BrF2O and a molecular weight of 160.95 g/mol. Its IUPAC name is 1-bromo-2,2-difluoroethanol.
| Compound Name | 1-bromo-2,2-difluoroethanol |
|---|---|
| PubChem CID | 87083635 |
| Molecular Formula | C2H3BrF2O |
| Molecular Weight | 160.95 g/mol |
| Exact Mass | 159.93 |
| IUPAC Name | 1-bromo-2,2-difluoroethanol |
| SMILES | OC(Br)C(F)F |
| InChI | InChI=1S/C2H3BrF2O/c3-1(6)2(4)5/h1-2,6H |
| InChIKey | CXVXKYXQOWNIHF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.95 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|