C2H3BrF3LiO — CID 175003537
lithium;1-bromo-2,2,2-trifluoroethanol;hydride (PubChem CID 175003537) has the molecular formula C2H3BrF3LiO and a molecular weight of 186.88 g/mol. Its IUPAC name is lithium;1-bromo-2,2,2-trifluoroethanol;hydride.
| Compound Name | lithium;1-bromo-2,2,2-trifluoroethanol;hydride |
|---|---|
| PubChem CID | 175003537 |
| Molecular Formula | C2H3BrF3LiO |
| Molecular Weight | 186.88 g/mol |
| Exact Mass | 185.95 |
| IUPAC Name | lithium;1-bromo-2,2,2-trifluoroethanol;hydride |
| SMILES | OC(Br)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C2H2BrF3O.Li.H/c3-1(7)2(4,5)6;;/h1,7H;;/q;+1;-1 |
| InChIKey | LGRGBHTXSDOPKP-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.88 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|