C5H2Br2F6O — CID 151490866
2,4-dibromo-1,1,1,5,5,5-hexafluoropentan-3-one (PubChem CID 151490866) has the molecular formula C5H2Br2F6O and a molecular weight of 351.87 g/mol. Its IUPAC name is 2,4-dibromo-1,1,1,5,5,5-hexafluoropentan-3-one.
| Compound Name | 2,4-dibromo-1,1,1,5,5,5-hexafluoropentan-3-one |
|---|---|
| PubChem CID | 151490866 |
| Molecular Formula | C5H2Br2F6O |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 349.84 |
| IUPAC Name | 2,4-dibromo-1,1,1,5,5,5-hexafluoropentan-3-one |
| SMILES | O=C(C(Br)C(F)(F)F)C(Br)C(F)(F)F |
| InChI | InChI=1S/C5H2Br2F6O/c6-2(4(8,9)10)1(14)3(7)5(11,12)13/h2-3H |
| InChIKey | POKVKWIQDWOZJQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|