C4H2BrF3O3 — CID 98469172
(2S)-2-bromo-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 98469172) has the molecular formula C4H2BrF3O3 and a molecular weight of 234.95 g/mol. Its IUPAC name is (2S)-2-bromo-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | (2S)-2-bromo-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 98469172 |
| Molecular Formula | C4H2BrF3O3 |
| Molecular Weight | 234.95 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | (2S)-2-bromo-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | O=C(O)[C@@H](Br)C(=O)C(F)(F)F |
| InChI | InChI=1S/C4H2BrF3O3/c5-1(3(10)11)2(9)4(6,7)8/h1H,(H,10,11)/t1-/m0/s1 |
| InChIKey | HOBTVVJAFKWNGB-SFOWXEAESA-N |
| XLogP | 0.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.95 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|