C10H7Br2F3O — CID 24756364
3,4-dibromo-1,1,1-trifluoro-4-phenylbutan-2-one (PubChem CID 24756364) has the molecular formula C10H7Br2F3O and a molecular weight of 359.97 g/mol. Its IUPAC name is 3,4-dibromo-1,1,1-trifluoro-4-phenylbutan-2-one.
| Compound Name | 3,4-dibromo-1,1,1-trifluoro-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 24756364 |
| Molecular Formula | C10H7Br2F3O |
| Molecular Weight | 359.97 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | 3,4-dibromo-1,1,1-trifluoro-4-phenylbutan-2-one |
| SMILES | O=C(C(Br)C(Br)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H7Br2F3O/c11-7(6-4-2-1-3-5-6)8(12)9(16)10(13,14)15/h1-5,7-8H |
| InChIKey | RFYBJFQRTSLAFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|