C15H10Br2Cl2O — CID 98068965
(2R,3S)-2,3-dibromo-1-(3,4-dichlorophenyl)-3-phenylpropan-1-one (PubChem CID 98068965) has the molecular formula C15H10Br2Cl2O and a molecular weight of 436.96 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromo-1-(3,4-dichlorophenyl)-3-phenylpropan-1-one.
| Compound Name | (2R,3S)-2,3-dibromo-1-(3,4-dichlorophenyl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 98068965 |
| Molecular Formula | C15H10Br2Cl2O |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 433.85 |
| IUPAC Name | (2R,3S)-2,3-dibromo-1-(3,4-dichlorophenyl)-3-phenylpropan-1-one |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)[C@@H](Br)[C@@H](Br)c1ccccc1 |
| InChI | InChI=1S/C15H10Br2Cl2O/c16-13(9-4-2-1-3-5-9)14(17)15(20)10-6-7-11(18)12(19)8-10/h1-8,13-14H/t13-,14-/m0/s1 |
| InChIKey | FMEOILDGUINWIW-KBPBESRZSA-N |
| XLogP | 6.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|