C16H10Cl2N2O2 — CID 98450152
(2R)-2-cyano-3-(3,4-dichlorophenyl)-3-oxo-N-phenylpropanamide (PubChem CID 98450152) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is (2R)-2-cyano-3-(3,4-dichlorophenyl)-3-oxo-N-phenylpropanamide.
| Compound Name | (2R)-2-cyano-3-(3,4-dichlorophenyl)-3-oxo-N-phenylpropanamide |
|---|---|
| PubChem CID | 98450152 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (2R)-2-cyano-3-(3,4-dichlorophenyl)-3-oxo-N-phenylpropanamide |
| SMILES | N#C[C@@H](C(=O)Nc1ccccc1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-13-7-6-10(8-14(13)18)15(21)12(9-19)16(22)20-11-4-2-1-3-5-11/h1-8,12H,(H,20,22)/t12-/m1/s1 |
| InChIKey | CAUKEZHFXIIDNY-GFCCVEGCSA-N |
| XLogP | 3.95 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|