C18H13ClN2O2 — CID 98548775
(Z,2S)-5-(4-chlorophenyl)-2-cyano-3-oxo-N-phenylpent-4-enamide (PubChem CID 98548775) has the molecular formula C18H13ClN2O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is (Z,2S)-5-(4-chlorophenyl)-2-cyano-3-oxo-N-phenylpent-4-enamide.
| Compound Name | (Z,2S)-5-(4-chlorophenyl)-2-cyano-3-oxo-N-phenylpent-4-enamide |
|---|---|
| PubChem CID | 98548775 |
| Molecular Formula | C18H13ClN2O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (Z,2S)-5-(4-chlorophenyl)-2-cyano-3-oxo-N-phenylpent-4-enamide |
| SMILES | N#C[C@@H](C(=O)/C=C\c1ccc(Cl)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H13ClN2O2/c19-14-9-6-13(7-10-14)8-11-17(22)16(12-20)18(23)21-15-4-2-1-3-5-15/h1-11,16H,(H,21,23)/b11-8-/t16-/m0/s1 |
| InChIKey | QINXCVRIDQGSLI-CLOOOTJHSA-N |
| XLogP | 3.70 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|