C10H10Cl3NO3 — CID 68768647
methyl 2-amino-3-(3,4-dichlorophenyl)-3-oxopropanoate;hydrochloride (PubChem CID 68768647) has the molecular formula C10H10Cl3NO3 and a molecular weight of 298.55 g/mol. Its IUPAC name is methyl 2-amino-3-(3,4-dichlorophenyl)-3-oxopropanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(3,4-dichlorophenyl)-3-oxopropanoate;hydrochloride |
|---|---|
| PubChem CID | 68768647 |
| Molecular Formula | C10H10Cl3NO3 |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | methyl 2-amino-3-(3,4-dichlorophenyl)-3-oxopropanoate;hydrochloride |
| SMILES | COC(=O)C(N)C(=O)c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C10H9Cl2NO3.ClH/c1-16-10(15)8(13)9(14)5-2-3-6(11)7(12)4-5;/h2-4,8H,13H2,1H3;1H |
| InChIKey | LKZVEMPKVBZNNF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|