C17H17Br2NO — CID 2788217
2,3-dibromo-3-phenyl-N-(1-phenylethyl)propanamide (PubChem CID 2788217) has the molecular formula C17H17Br2NO and a molecular weight of 411.14 g/mol. Its IUPAC name is 2,3-dibromo-3-phenyl-N-(1-phenylethyl)propanamide.
| Compound Name | 2,3-dibromo-3-phenyl-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 2788217 |
| Molecular Formula | C17H17Br2NO |
| Molecular Weight | 411.14 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 2,3-dibromo-3-phenyl-N-(1-phenylethyl)propanamide |
| SMILES | CC(NC(=O)C(Br)C(Br)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17Br2NO/c1-12(13-8-4-2-5-9-13)20-17(21)16(19)15(18)14-10-6-3-7-11-14/h2-12,15-16H,1H3,(H,20,21) |
| InChIKey | NCEFWYGCAXBQQH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|