C12H15Br2NO — CID 129088961
3-bromo-2-(bromomethyl)-N-[(1R)-1-phenylethyl]propanamide (PubChem CID 129088961) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 3-bromo-2-(bromomethyl)-N-[(1R)-1-phenylethyl]propanamide.
| Compound Name | 3-bromo-2-(bromomethyl)-N-[(1R)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 129088961 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 3-bromo-2-(bromomethyl)-N-[(1R)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](NC(=O)C(CBr)CBr)c1ccccc1 |
| InChI | InChI=1S/C12H15Br2NO/c1-9(10-5-3-2-4-6-10)15-12(16)11(7-13)8-14/h2-6,9,11H,7-8H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | QYXKBMCJYWBIIR-SECBINFHSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|