2-amino-4,4,4-trifluoro-3-oxobutanoic acid

C4H4F3NO3 — CID 23453164

IUPAC2-amino-4,4,4-trifluoro-3-oxobutanoic acid
SMILESNC(C(=O)O)C(=O)C(F)(F)F
InChIInChI=1S/C4H4F3NO3/c5-4(6,7)2(9)1(8)3(10)11/h1H,8H2,(H,10,11)
InChIKeyIBESMUIXCWIRDY-UHFFFAOYSA-N
MW171.07 g/mol
LogP-0.47
Rot. Bonds2

About 2-amino-4,4,4-trifluoro-3-oxobutanoic acid

2-amino-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 23453164) has the molecular formula C4H4F3NO3 and a molecular weight of 171.07 g/mol. Its IUPAC name is 2-amino-4,4,4-trifluoro-3-oxobutanoic acid.

Molecular Properties

Compound Name2-amino-4,4,4-trifluoro-3-oxobutanoic acid
PubChem CID23453164
Molecular FormulaC4H4F3NO3
Molecular Weight171.07 g/mol
Exact Mass171.01
IUPAC Name2-amino-4,4,4-trifluoro-3-oxobutanoic acid
SMILESNC(C(=O)O)C(=O)C(F)(F)F
InChIInChI=1S/C4H4F3NO3/c5-4(6,7)2(9)1(8)3(10)11/h1H,8H2,(H,10,11)
InChIKeyIBESMUIXCWIRDY-UHFFFAOYSA-N
XLogP-0.47
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.07
LogP ≤ 5-0.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-amino-4,4,4-trifluoro-3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4,4,4-trifluoro-3-oxobutanoic acid?
The IUPAC name of 2-amino-4,4,4-trifluoro-3-oxobutanoic acid (CID 23453164) is 2-amino-4,4,4-trifluoro-3-oxobutanoic acid.
What is the SMILES notation for 2-amino-4,4,4-trifluoro-3-oxobutanoic acid?
The canonical SMILES for 2-amino-4,4,4-trifluoro-3-oxobutanoic acid is NC(C(=O)O)C(=O)C(F)(F)F.
What is the InChIKey of 2-amino-4,4,4-trifluoro-3-oxobutanoic acid?
The InChIKey is IBESMUIXCWIRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F3NO3/c5-4(6,7)2(9)1(8)3(10)11/h1H,8H2,(H,10,11).
What are the key properties of 2-amino-4,4,4-trifluoro-3-oxobutanoic acid?
2-amino-4,4,4-trifluoro-3-oxobutanoic acid has a molecular weight of 171.07 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,4,4-trifluoro-3-oxobutanoic acid is sourced from PubChem (CID 23453164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).