About Fluorovinylglycine
Fluorovinylglycine (PubChem CID 3081008) has the molecular formula C4H6FNO2
and a molecular weight of 119.09 g/mol. Its IUPAC name is 2-amino-3-fluorobut-3-enoic acid.
Molecular Properties
| Compound Name | Fluorovinylglycine |
| PubChem CID | 3081008 |
| Molecular Formula | C4H6FNO2 |
| Molecular Weight | 119.09 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 2-amino-3-fluorobut-3-enoic acid |
| SMILES | C=C(C(C(=O)O)N)F |
| InChI | InChI=1S/C4H6FNO2/c1-2(5)3(6)4(7)8/h3H,1,6H2,(H,7,8) |
| InChIKey | HMOXWHQSNHKKFM-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | 123 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.09 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Fluorovinylglycine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Fluorovinylglycine?
The IUPAC name of Fluorovinylglycine (CID 3081008) is 2-amino-3-fluorobut-3-enoic acid.
What is the SMILES notation for Fluorovinylglycine?
The canonical SMILES for Fluorovinylglycine is C=C(C(C(=O)O)N)F.
What is the InChIKey of Fluorovinylglycine?
The InChIKey is HMOXWHQSNHKKFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FNO2/c1-2(5)3(6)4(7)8/h3H,1,6H2,(H,7,8).
What are the key properties of Fluorovinylglycine?
Fluorovinylglycine has a molecular weight of 119.09 g/mol, XLogP of -2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Fluorovinylglycine is sourced from PubChem (CID 3081008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).