C5H5AlF6O2 — CID 174770682
alumane;1,1,1,3,5,5-hexafluoropentane-2,4-dione (PubChem CID 174770682) has the molecular formula C5H5AlF6O2 and a molecular weight of 238.06 g/mol. Its IUPAC name is alumane;1,1,1,3,5,5-hexafluoropentane-2,4-dione.
| Compound Name | alumane;1,1,1,3,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 174770682 |
| Molecular Formula | C5H5AlF6O2 |
| Molecular Weight | 238.06 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | alumane;1,1,1,3,5,5-hexafluoropentane-2,4-dione |
| SMILES | O=C(C(F)F)C(F)C(=O)C(F)(F)F.[AlH3] |
| InChI | InChI=1S/C5H2F6O2.Al.3H/c6-1(2(12)4(7)8)3(13)5(9,10)11;;;;/h1,4H;;;; |
| InChIKey | AQAAVEDWXGKWRU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.06 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|