C5H7F3O4 — CID 152743649
(3S,4R)-1,1,1-trifluoro-3,4,5-trihydroxypentan-2-one (PubChem CID 152743649) has the molecular formula C5H7F3O4 and a molecular weight of 188.10 g/mol. Its IUPAC name is (3S,4R)-1,1,1-trifluoro-3,4,5-trihydroxypentan-2-one.
| Compound Name | (3S,4R)-1,1,1-trifluoro-3,4,5-trihydroxypentan-2-one |
|---|---|
| PubChem CID | 152743649 |
| Molecular Formula | C5H7F3O4 |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | (3S,4R)-1,1,1-trifluoro-3,4,5-trihydroxypentan-2-one |
| SMILES | O=C([C@@H](O)[C@H](O)CO)C(F)(F)F |
| InChI | InChI=1S/C5H7F3O4/c6-5(7,8)4(12)3(11)2(10)1-9/h2-3,9-11H,1H2/t2-,3+/m1/s1 |
| InChIKey | WIQXAULCPNNCOP-GBXIJSLDSA-N |
| XLogP | -1.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |