C4H9ClO5 — CID 162317109
(2R,3S)-2,3,4-trihydroxybutanoic acid;hydrochloride (PubChem CID 162317109) has the molecular formula C4H9ClO5 and a molecular weight of 172.56 g/mol. Its IUPAC name is (2R,3S)-2,3,4-trihydroxybutanoic acid;hydrochloride.
| Compound Name | (2R,3S)-2,3,4-trihydroxybutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162317109 |
| Molecular Formula | C4H9ClO5 |
| Molecular Weight | 172.56 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | (2R,3S)-2,3,4-trihydroxybutanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H8O5.ClH/c5-1-2(6)3(7)4(8)9;/h2-3,5-7H,1H2,(H,8,9);1H/t2-,3+;/m0./s1 |
| InChIKey | NHAXPAIYACYJKN-LJUKVTEVSA-N |
| XLogP | -1.79 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.56 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |