C7H8F3NO3 — CID 123483063
2-(C,N-dimethylcarbonimidoyl)-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 123483063) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 123483063 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | C/N=C(\C)C(C(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3/c1-3(11-2)4(6(13)14)5(12)7(8,9)10/h4H,1-2H3,(H,13,14)/b11-3+ |
| InChIKey | GRGHOBIBMFADQC-QDEBKDIKSA-N |
| XLogP | 0.91 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|