C14H27NO2 — CID 144957620
(2S,3S)-3-(C,N-dimethylcarbonimidoyl)-5-methyl-2-(2-methylpropyl)hexanoic acid (PubChem CID 144957620) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (2S,3S)-3-(C,N-dimethylcarbonimidoyl)-5-methyl-2-(2-methylpropyl)hexanoic acid.
| Compound Name | (2S,3S)-3-(C,N-dimethylcarbonimidoyl)-5-methyl-2-(2-methylpropyl)hexanoic acid |
|---|---|
| PubChem CID | 144957620 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2S,3S)-3-(C,N-dimethylcarbonimidoyl)-5-methyl-2-(2-methylpropyl)hexanoic acid |
| SMILES | C/N=C(\C)[C@@H](CC(C)C)[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H27NO2/c1-9(2)7-12(11(5)15-6)13(14(16)17)8-10(3)4/h9-10,12-13H,7-8H2,1-6H3,(H,16,17)/b15-11+/t12-,13+/m1/s1 |
| InChIKey | ZTDZNBDYTYWSHB-XFUXPEIASA-N |
| XLogP | 3.49 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|