About 2-acetyl-3-oxobutanoic acid;hydrate
2-acetyl-3-oxobutanoic acid;hydrate (PubChem CID 162326533) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is 2-acetyl-3-oxobutanoic acid;hydrate.
Molecular Properties
| Compound Name | 2-acetyl-3-oxobutanoic acid;hydrate |
| PubChem CID | 162326533 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2-acetyl-3-oxobutanoic acid;hydrate |
| SMILES | CC(=O)C(C(C)=O)C(=O)O.O |
| InChI | InChI=1S/C6H8O4.H2O/c1-3(7)5(4(2)8)6(9)10;/h5H,1-2H3,(H,9,10);1H2 |
| InChIKey | ZIDLYJGVHWSXDR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-oxobutanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-oxobutanoic acid;hydrate?
The IUPAC name of 2-acetyl-3-oxobutanoic acid;hydrate (CID 162326533) is 2-acetyl-3-oxobutanoic acid;hydrate.
What is the SMILES notation for 2-acetyl-3-oxobutanoic acid;hydrate?
The canonical SMILES for 2-acetyl-3-oxobutanoic acid;hydrate is CC(=O)C(C(C)=O)C(=O)O.O.
What is the InChIKey of 2-acetyl-3-oxobutanoic acid;hydrate?
The InChIKey is ZIDLYJGVHWSXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4.H2O/c1-3(7)5(4(2)8)6(9)10;/h5H,1-2H3,(H,9,10);1H2.
What are the key properties of 2-acetyl-3-oxobutanoic acid;hydrate?
2-acetyl-3-oxobutanoic acid;hydrate has a molecular weight of 162.14 g/mol, XLogP of -0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-oxobutanoic acid;hydrate is sourced from PubChem (CID 162326533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).