About 2-acetyl-3-oxobutanoic acid;dioctyltin
2-acetyl-3-oxobutanoic acid;dioctyltin (PubChem CID 174495753) has the molecular formula C22H42O4Sn
and a molecular weight of 489.29 g/mol. Its IUPAC name is 2-acetyl-3-oxobutanoic acid;dioctyltin.
Molecular Properties
| Compound Name | 2-acetyl-3-oxobutanoic acid;dioctyltin |
| PubChem CID | 174495753 |
| Molecular Formula | C22H42O4Sn |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-acetyl-3-oxobutanoic acid;dioctyltin |
| SMILES | CC(=O)C(C(C)=O)C(=O)O.CCCCCCCC[Sn]CCCCCCCC |
| InChI | InChI=1S/2C8H17.C6H8O4.Sn/c2*1-3-5-7-8-6-4-2;1-3(7)5(4(2)8)6(9)10;/h2*1,3-8H2,2H3;5H,1-2H3,(H,9,10); |
| InChIKey | AFRIKCSXKXBWKK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-oxobutanoic acid;dioctyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-oxobutanoic acid;dioctyltin?
The IUPAC name of 2-acetyl-3-oxobutanoic acid;dioctyltin (CID 174495753) is 2-acetyl-3-oxobutanoic acid;dioctyltin.
What is the SMILES notation for 2-acetyl-3-oxobutanoic acid;dioctyltin?
The canonical SMILES for 2-acetyl-3-oxobutanoic acid;dioctyltin is CC(=O)C(C(C)=O)C(=O)O.CCCCCCCC[Sn]CCCCCCCC.
What is the InChIKey of 2-acetyl-3-oxobutanoic acid;dioctyltin?
The InChIKey is AFRIKCSXKXBWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.C6H8O4.Sn/c2*1-3-5-7-8-6-4-2;1-3(7)5(4(2)8)6(9)10;/h2*1,3-8H2,2H3;5H,1-2H3,(H,9,10);.
What are the key properties of 2-acetyl-3-oxobutanoic acid;dioctyltin?
2-acetyl-3-oxobutanoic acid;dioctyltin has a molecular weight of 489.29 g/mol, XLogP of 6.11, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-oxobutanoic acid;dioctyltin is sourced from PubChem (CID 174495753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).