About dioctyltin;3-ethylpentan-2-one
dioctyltin;3-ethylpentan-2-one (PubChem CID 175380783) has the molecular formula C23H48OSn
and a molecular weight of 459.35 g/mol. Its IUPAC name is dioctyltin;3-ethylpentan-2-one.
Molecular Properties
| Compound Name | dioctyltin;3-ethylpentan-2-one |
| PubChem CID | 175380783 |
| Molecular Formula | C23H48OSn |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | dioctyltin;3-ethylpentan-2-one |
| SMILES | CCC(CC)C(C)=O.CCCCCCCC[Sn]CCCCCCCC |
| InChI | InChI=1S/2C8H17.C7H14O.Sn/c2*1-3-5-7-8-6-4-2;1-4-7(5-2)6(3)8;/h2*1,3-8H2,2H3;7H,4-5H2,1-3H3; |
| InChIKey | IMWPIHKESFWKQE-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin;3-ethylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin;3-ethylpentan-2-one?
The IUPAC name of dioctyltin;3-ethylpentan-2-one (CID 175380783) is dioctyltin;3-ethylpentan-2-one.
What is the SMILES notation for dioctyltin;3-ethylpentan-2-one?
The canonical SMILES for dioctyltin;3-ethylpentan-2-one is CCC(CC)C(C)=O.CCCCCCCC[Sn]CCCCCCCC.
What is the InChIKey of dioctyltin;3-ethylpentan-2-one?
The InChIKey is IMWPIHKESFWKQE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.C7H14O.Sn/c2*1-3-5-7-8-6-4-2;1-4-7(5-2)6(3)8;/h2*1,3-8H2,2H3;7H,4-5H2,1-3H3;.
What are the key properties of dioctyltin;3-ethylpentan-2-one?
dioctyltin;3-ethylpentan-2-one has a molecular weight of 459.35 g/mol, XLogP of 8.26, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin;3-ethylpentan-2-one is sourced from PubChem (CID 175380783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).