C20H38O2 — CID 150805323
7,10-diethylhexadecane-8,9-dione (PubChem CID 150805323) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 7,10-diethylhexadecane-8,9-dione.
| Compound Name | 7,10-diethylhexadecane-8,9-dione |
|---|---|
| PubChem CID | 150805323 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 7,10-diethylhexadecane-8,9-dione |
| SMILES | CCCCCCC(CC)C(=O)C(=O)C(CC)CCCCCC |
| InChI | InChI=1S/C20H38O2/c1-5-9-11-13-15-17(7-3)19(21)20(22)18(8-4)16-14-12-10-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | KGSYTSDPQXEXRJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|