About 5-ethylundecan-4-one
5-ethylundecan-4-one (PubChem CID 11687075) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 5-ethylundecan-4-one.
Molecular Properties
| Compound Name | 5-ethylundecan-4-one |
| PubChem CID | 11687075 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 5-ethylundecan-4-one |
| SMILES | CCCCCCC(CC)C(=O)CCC |
| InChI | InChI=1S/C13H26O/c1-4-7-8-9-11-12(6-3)13(14)10-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | DVNNCHCOETZLSW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylundecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylundecan-4-one?
The IUPAC name of 5-ethylundecan-4-one (CID 11687075) is 5-ethylundecan-4-one.
What is the SMILES notation for 5-ethylundecan-4-one?
The canonical SMILES for 5-ethylundecan-4-one is CCCCCCC(CC)C(=O)CCC.
What is the InChIKey of 5-ethylundecan-4-one?
The InChIKey is DVNNCHCOETZLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-4-7-8-9-11-12(6-3)13(14)10-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 5-ethylundecan-4-one?
5-ethylundecan-4-one has a molecular weight of 198.35 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylundecan-4-one is sourced from PubChem (CID 11687075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).