About ethyl 3-butanoylnonanoate
ethyl 3-butanoylnonanoate (PubChem CID 18322309) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is ethyl 3-butanoylnonanoate.
Molecular Properties
| Compound Name | ethyl 3-butanoylnonanoate |
| PubChem CID | 18322309 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | ethyl 3-butanoylnonanoate |
| SMILES | CCCCCCC(CC(=O)OCC)C(=O)CCC |
| InChI | InChI=1S/C15H28O3/c1-4-7-8-9-11-13(14(16)10-5-2)12-15(17)18-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | ODKOLUKPSBNGPW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-butanoylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-butanoylnonanoate?
The IUPAC name of ethyl 3-butanoylnonanoate (CID 18322309) is ethyl 3-butanoylnonanoate.
What is the SMILES notation for ethyl 3-butanoylnonanoate?
The canonical SMILES for ethyl 3-butanoylnonanoate is CCCCCCC(CC(=O)OCC)C(=O)CCC.
What is the InChIKey of ethyl 3-butanoylnonanoate?
The InChIKey is ODKOLUKPSBNGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-4-7-8-9-11-13(14(16)10-5-2)12-15(17)18-6-3/h13H,4-12H2,1-3H3.
What are the key properties of ethyl 3-butanoylnonanoate?
ethyl 3-butanoylnonanoate has a molecular weight of 256.39 g/mol, XLogP of 3.90, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-butanoylnonanoate is sourced from PubChem (CID 18322309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).