About boric acid;di(nonyl)tin
boric acid;di(nonyl)tin (PubChem CID 174438027) has the molecular formula C18H41BO3Sn
and a molecular weight of 435.05 g/mol. Its IUPAC name is boric acid;di(nonyl)tin.
Molecular Properties
| Compound Name | boric acid;di(nonyl)tin |
| PubChem CID | 174438027 |
| Molecular Formula | C18H41BO3Sn |
| Molecular Weight | 435.05 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | boric acid;di(nonyl)tin |
| SMILES | CCCCCCCCC[Sn]CCCCCCCCC.OB(O)O |
| InChI | InChI=1S/2C9H19.BH3O3.Sn/c2*1-3-5-7-9-8-6-4-2;2-1(3)4;/h2*1,3-9H2,2H3;2-4H; |
| InChIKey | MTTGCUIXYNRSBB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;di(nonyl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;di(nonyl)tin?
The IUPAC name of boric acid;di(nonyl)tin (CID 174438027) is boric acid;di(nonyl)tin.
What is the SMILES notation for boric acid;di(nonyl)tin?
The canonical SMILES for boric acid;di(nonyl)tin is CCCCCCCCC[Sn]CCCCCCCCC.OB(O)O.
What is the InChIKey of boric acid;di(nonyl)tin?
The InChIKey is MTTGCUIXYNRSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H19.BH3O3.Sn/c2*1-3-5-7-9-8-6-4-2;2-1(3)4;/h2*1,3-9H2,2H3;2-4H;.
What are the key properties of boric acid;di(nonyl)tin?
boric acid;di(nonyl)tin has a molecular weight of 435.05 g/mol, XLogP of 4.98, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;di(nonyl)tin is sourced from PubChem (CID 174438027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).