About chloroethene;dioctyltin
chloroethene;dioctyltin (PubChem CID 158196482) has the molecular formula C18H37ClSn
and a molecular weight of 407.66 g/mol. Its IUPAC name is chloroethene;dioctyltin.
Molecular Properties
| Compound Name | chloroethene;dioctyltin |
| PubChem CID | 158196482 |
| Molecular Formula | C18H37ClSn |
| Molecular Weight | 407.66 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | chloroethene;dioctyltin |
| SMILES | C=CCl.CCCCCCCC[Sn]CCCCCCCC |
| InChI | InChI=1S/2C8H17.C2H3Cl.Sn/c2*1-3-5-7-8-6-4-2;1-2-3;/h2*1,3-8H2,2H3;2H,1H2; |
| InChIKey | GAJYJNMLVORKMA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.66 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze chloroethene;dioctyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethene;dioctyltin?
The IUPAC name of chloroethene;dioctyltin (CID 158196482) is chloroethene;dioctyltin.
What is the SMILES notation for chloroethene;dioctyltin?
The canonical SMILES for chloroethene;dioctyltin is C=CCl.CCCCCCCC[Sn]CCCCCCCC.
What is the InChIKey of chloroethene;dioctyltin?
The InChIKey is GAJYJNMLVORKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.C2H3Cl.Sn/c2*1-3-5-7-8-6-4-2;1-2-3;/h2*1,3-8H2,2H3;2H,1H2;.
What are the key properties of chloroethene;dioctyltin?
chloroethene;dioctyltin has a molecular weight of 407.66 g/mol, XLogP of 7.62, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethene;dioctyltin is sourced from PubChem (CID 158196482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).